| Name | 5-fluoro-1,3-thiazol-2-amine hydrochloride (1:1) |
| Synonyms | 2-Amine-5-Fluorothiazol HCL 5-Fluorothiazol-2-aMine HCl 2-AMino-5-fluorothiazole HCl 5-FLUOROTHIAZOL-2-AMINE HYDROCHLORIDE 5-Fluorothiazole-2-aMine hydrochloride 5-Fluroro-2-thiazolaMine hydrochloride 5-Fluoro-1,3-thiazol-2-amine hydrochloride 2-Amino-5-fluoro-1,3-thiazole hydrochloride |
| CAS | 745053-64-9 |
| InChI | InChI=1/C3H3FN2S.ClH/c4-2-1-6-3(5)7-2;/h1H,(H2,5,6);1H |
| Molecular Formula | C3H3FN2S.HCl |
| Molar Mass | 154.59 |
| Melting Point | 138-143°C |
| Boling Point | 221.8°C at 760 mmHg |
| Flash Point | 88°C |
| Vapor Presure | 0.105mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| WGK Germany | 3 |
| Use | 5-fluorothiazol-2-amine hydrochloride is a heterocyclic derivative and can be used as a pharmaceutical intermediate. |
| preparation | 2-aminothiazole as the starting material, using amino-protected, brominated, fluorinated, an important intermediate for the preparation of Glucokinase Activator, 2-amino-5-fluorothiazole hydrochloride, was synthesized by deprotection to salt reaction. The synthesis reaction formula is as follows: |